C34H68O8Si2 — CID 11125199
(3E)-1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6,6-trimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodeca-3,11-dien-5-one (PubChem CID 11125199) has the molecular formula C34H68O8Si2 and a molecular weight of 661.08 g/mol. Its IUPAC name is (3E)-1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6,6-trimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodeca-3,11-dien-5-one.
| Compound Name | (3E)-1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6,6-trimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 11125199 |
| Molecular Formula | C34H68O8Si2 |
| Molecular Weight | 661.08 g/mol |
| Exact Mass | 660.45 |
| IUPAC Name | (3E)-1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6,6-trimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodeca-3,11-dien-5-one |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)CC(CC(OC)(OC)C(=O)/C=C(/OC)C(C)CO[Si](C)(C)C(C)(C)C)OC(C)(C)OC |
| InChI | InChI=1S/C34H68O8Si2/c1-19-27(20-21-40-43(15,16)31(3,4)5)22-28(42-33(9,10)37-12)24-34(38-13,39-14)30(35)23-29(36-11)26(2)25-41-44(17,18)32(6,7)8/h19,23,26-28H,1,20-22,24-25H2,2-18H3/b29-23+ |
| InChIKey | ZJFYLZFHLBLLCD-BYNJWEBRSA-N |
| XLogP | 8.49 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.08 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|