C50H48O4 — CID 10628603
11,23-bis(4-ethenylphenyl)-26,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol (PubChem CID 10628603) has the molecular formula C50H48O4 and a molecular weight of 712.93 g/mol. Its IUPAC name is 11,23-bis(4-ethenylphenyl)-26,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol.
| Compound Name | 11,23-bis(4-ethenylphenyl)-26,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 10628603 |
| Molecular Formula | C50H48O4 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.36 |
| IUPAC Name | 11,23-bis(4-ethenylphenyl)-26,28-dipropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-25,27-diol |
| SMILES | C=Cc1ccc(-c2cc3c(O)c(c2)Cc2cccc(c2OCCC)Cc2cc(-c4ccc(C=C)cc4)cc(c2O)Cc2cccc(c2OCCC)C3)cc1 |
| InChI | InChI=1S/C50H48O4/c1-5-23-53-49-37-11-9-12-38(49)26-44-30-42(36-21-17-34(8-4)18-22-36)32-46(48(44)52)28-40-14-10-13-39(50(40)54-24-6-2)27-45-31-41(29-43(25-37)47(45)51)35-19-15-33(7-3)16-20-35/h7-22,29-32,51-52H,3-6,23-28H2,1-2H3 |
| InChIKey | BVPSBVPKDCLYIZ-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |