C16H26N2O3 — CID 106287098
2-[(3-ethyl-2-hydroxypentyl)amino]-6-propylpyridine-4-carboxylic acid (PubChem CID 106287098) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[(3-ethyl-2-hydroxypentyl)amino]-6-propylpyridine-4-carboxylic acid.
| Compound Name | 2-[(3-ethyl-2-hydroxypentyl)amino]-6-propylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106287098 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-[(3-ethyl-2-hydroxypentyl)amino]-6-propylpyridine-4-carboxylic acid |
| SMILES | CCCc1cc(C(=O)O)cc(NCC(O)C(CC)CC)n1 |
| InChI | InChI=1S/C16H26N2O3/c1-4-7-13-8-12(16(20)21)9-15(18-13)17-10-14(19)11(5-2)6-3/h8-9,11,14,19H,4-7,10H2,1-3H3,(H,17,18)(H,20,21) |
| InChIKey | GQLFWQNKNHDTOL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |