C12H19N3O3 — CID 106287196
6-[(3-ethyl-2-hydroxypentyl)amino]pyrazine-2-carboxylic acid (PubChem CID 106287196) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-[(3-ethyl-2-hydroxypentyl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 6-[(3-ethyl-2-hydroxypentyl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 106287196 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 6-[(3-ethyl-2-hydroxypentyl)amino]pyrazine-2-carboxylic acid |
| SMILES | CCC(CC)C(O)CNc1cncc(C(=O)O)n1 |
| InChI | InChI=1S/C12H19N3O3/c1-3-8(4-2)10(16)6-14-11-7-13-5-9(15-11)12(17)18/h5,7-8,10,16H,3-4,6H2,1-2H3,(H,14,15)(H,17,18) |
| InChIKey | RXAHGUFUQFYTJQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |