C13H16F4N2O2 — CID 106289625
1-(3-nitrophenyl)-N-(2,2,3,3-tetrafluoropropyl)butan-1-amine (PubChem CID 106289625) has the molecular formula C13H16F4N2O2 and a molecular weight of 308.27 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-N-(2,2,3,3-tetrafluoropropyl)butan-1-amine.
| Compound Name | 1-(3-nitrophenyl)-N-(2,2,3,3-tetrafluoropropyl)butan-1-amine |
|---|---|
| PubChem CID | 106289625 |
| Molecular Formula | C13H16F4N2O2 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(3-nitrophenyl)-N-(2,2,3,3-tetrafluoropropyl)butan-1-amine |
| SMILES | CCCC(NCC(F)(F)C(F)F)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16F4N2O2/c1-2-4-11(18-8-13(16,17)12(14)15)9-5-3-6-10(7-9)19(20)21/h3,5-7,11-12,18H,2,4,8H2,1H3 |
| InChIKey | CUJLSFVLBQGVGR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|