C16H21N3O2 — CID 79107733
2,5-dimethyl-N-[1-(3-nitrophenyl)butyl]pyrrol-1-amine (PubChem CID 79107733) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2,5-dimethyl-N-[1-(3-nitrophenyl)butyl]pyrrol-1-amine.
| Compound Name | 2,5-dimethyl-N-[1-(3-nitrophenyl)butyl]pyrrol-1-amine |
|---|---|
| PubChem CID | 79107733 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2,5-dimethyl-N-[1-(3-nitrophenyl)butyl]pyrrol-1-amine |
| SMILES | CCCC(Nn1c(C)ccc1C)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O2/c1-4-6-16(17-18-12(2)9-10-13(18)3)14-7-5-8-15(11-14)19(20)21/h5,7-11,16-17H,4,6H2,1-3H3 |
| InChIKey | OMOHQJVBKTVQQR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|