C9H15F4NO — CID 106289850
4-(2,2,3,3-tetrafluoropropylamino)cyclohexan-1-ol (PubChem CID 106289850) has the molecular formula C9H15F4NO and a molecular weight of 229.22 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropylamino)cyclohexan-1-ol.
| Compound Name | 4-(2,2,3,3-tetrafluoropropylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 106289850 |
| Molecular Formula | C9H15F4NO |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropylamino)cyclohexan-1-ol |
| SMILES | OC1CCC(NCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C9H15F4NO/c10-8(11)9(12,13)5-14-6-1-3-7(15)4-2-6/h6-8,14-15H,1-5H2 |
| InChIKey | WEDMNZLLGHAXAI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|