C8H17F3N2O3S — CID 106290432
2-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol (PubChem CID 106290432) has the molecular formula C8H17F3N2O3S and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol.
| Compound Name | 2-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol |
|---|---|
| PubChem CID | 106290432 |
| Molecular Formula | C8H17F3N2O3S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-methyl-1-(2,2,2-trifluoroethylsulfamoylamino)pentan-2-ol |
| SMILES | CCCC(C)(O)CNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N2O3S/c1-3-4-7(2,14)5-12-17(15,16)13-6-8(9,10)11/h12-14H,3-6H2,1-2H3 |
| InChIKey | JBSMUCPEIMUAPY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |