C12H18F4N2O2 — CID 106290775
3-butan-2-yl-6-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione (PubChem CID 106290775) has the molecular formula C12H18F4N2O2 and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-butan-2-yl-6-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione.
| Compound Name | 3-butan-2-yl-6-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 106290775 |
| Molecular Formula | C12H18F4N2O2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-butan-2-yl-6-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione |
| SMILES | CCC(C)C1NC(=O)C(C)N(CC(F)(F)C(F)F)C1=O |
| InChI | InChI=1S/C12H18F4N2O2/c1-4-6(2)8-10(20)18(7(3)9(19)17-8)5-12(15,16)11(13)14/h6-8,11H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | JJLQWTXWUALJCP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|