C11H16F4N2O2 — CID 106290691
3-methyl-6-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione (PubChem CID 106290691) has the molecular formula C11H16F4N2O2 and a molecular weight of 284.25 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione.
| Compound Name | 3-methyl-6-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 106290691 |
| Molecular Formula | C11H16F4N2O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-methyl-6-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine-2,5-dione |
| SMILES | CC1NC(=O)C(C(C)C)N(CC(F)(F)C(F)F)C1=O |
| InChI | InChI=1S/C11H16F4N2O2/c1-5(2)7-8(18)16-6(3)9(19)17(7)4-11(14,15)10(12)13/h5-7,10H,4H2,1-3H3,(H,16,18) |
| InChIKey | QAFAPAUGDSSGRS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|