C14H26N2O2 — CID 64970004
3-methyl-1-(4-methylpentyl)-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 64970004) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-methyl-1-(4-methylpentyl)-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 3-methyl-1-(4-methylpentyl)-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64970004 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 3-methyl-1-(4-methylpentyl)-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)CCCN1C(=O)C(C)NC(=O)C1C(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-9(2)7-6-8-16-12(10(3)4)13(17)15-11(5)14(16)18/h9-12H,6-8H2,1-5H3,(H,15,17) |
| InChIKey | IPMNPDKXMKZUIZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |