C15H28N2O2 — CID 64872808
1-(3-methylbutyl)-3,6-di(propan-2-yl)piperazine-2,5-dione (PubChem CID 64872808) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3,6-di(propan-2-yl)piperazine-2,5-dione.
| Compound Name | 1-(3-methylbutyl)-3,6-di(propan-2-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64872808 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-(3-methylbutyl)-3,6-di(propan-2-yl)piperazine-2,5-dione |
| SMILES | CC(C)CCN1C(=O)C(C(C)C)NC(=O)C1C(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-9(2)7-8-17-13(11(5)6)14(18)16-12(10(3)4)15(17)19/h9-13H,7-8H2,1-6H3,(H,16,18) |
| InChIKey | MFXXJSMDRCZMTI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |