C6H9F4N5 — CID 106291385
2,2,3,3-tetrafluoro-N-[(2-methyltetrazol-5-yl)methyl]propan-1-amine (PubChem CID 106291385) has the molecular formula C6H9F4N5 and a molecular weight of 227.16 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(2-methyltetrazol-5-yl)methyl]propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(2-methyltetrazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106291385 |
| Molecular Formula | C6H9F4N5 |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(2-methyltetrazol-5-yl)methyl]propan-1-amine |
| SMILES | Cn1nnc(CNCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C6H9F4N5/c1-15-13-4(12-14-15)2-11-3-6(9,10)5(7)8/h5,11H,2-3H2,1H3 |
| InChIKey | UDORKKAERSPIDF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|