C13H16F4N2OS — CID 106291416
5-ethyl-5-methyl-3-(2,2,3,3-tetrafluoropropyl)-2-thiophen-2-ylimidazolidin-4-one (PubChem CID 106291416) has the molecular formula C13H16F4N2OS and a molecular weight of 324.34 g/mol. Its IUPAC name is 5-ethyl-5-methyl-3-(2,2,3,3-tetrafluoropropyl)-2-thiophen-2-ylimidazolidin-4-one.
| Compound Name | 5-ethyl-5-methyl-3-(2,2,3,3-tetrafluoropropyl)-2-thiophen-2-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 106291416 |
| Molecular Formula | C13H16F4N2OS |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-ethyl-5-methyl-3-(2,2,3,3-tetrafluoropropyl)-2-thiophen-2-ylimidazolidin-4-one |
| SMILES | CCC1(C)NC(c2cccs2)N(CC(F)(F)C(F)F)C1=O |
| InChI | InChI=1S/C13H16F4N2OS/c1-3-12(2)11(20)19(7-13(16,17)10(14)15)9(18-12)8-5-4-6-21-8/h4-6,9-10,18H,3,7H2,1-2H3 |
| InChIKey | AANKUHSEBXGAQP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|