C10H16F4N2O2 — CID 106291682
4-(ethylamino)-N-(2,2,3,3-tetrafluoropropyl)oxolane-3-carboxamide (PubChem CID 106291682) has the molecular formula C10H16F4N2O2 and a molecular weight of 272.24 g/mol. Its IUPAC name is 4-(ethylamino)-N-(2,2,3,3-tetrafluoropropyl)oxolane-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-(2,2,3,3-tetrafluoropropyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 106291682 |
| Molecular Formula | C10H16F4N2O2 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-(ethylamino)-N-(2,2,3,3-tetrafluoropropyl)oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4N2O2/c1-2-15-7-4-18-3-6(7)8(17)16-5-10(13,14)9(11)12/h6-7,9,15H,2-5H2,1H3,(H,16,17) |
| InChIKey | VQPHXHICGAZXNO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|