C12H24N2O4S — CID 79549781
4-(ethylamino)-N-(2-methyl-2-methylsulfonylpropyl)oxolane-3-carboxamide (PubChem CID 79549781) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-(ethylamino)-N-(2-methyl-2-methylsulfonylpropyl)oxolane-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-(2-methyl-2-methylsulfonylpropyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 79549781 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-(ethylamino)-N-(2-methyl-2-methylsulfonylpropyl)oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)NCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H24N2O4S/c1-5-13-10-7-18-6-9(10)11(15)14-8-12(2,3)19(4,16)17/h9-10,13H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | JUFLMIQGIPUGRU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |