C9H18N2O4S — CID 103306914
4-(ethylamino)-N-ethylsulfonyloxolane-3-carboxamide (PubChem CID 103306914) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-(ethylamino)-N-ethylsulfonyloxolane-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-ethylsulfonyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 103306914 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-(ethylamino)-N-ethylsulfonyloxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)NS(=O)(=O)CC |
| InChI | InChI=1S/C9H18N2O4S/c1-3-10-8-6-15-5-7(8)9(12)11-16(13,14)4-2/h7-8,10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | BTQPLTJYOKBMTH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |