C11H22N2O4S — CID 66259891
4-(ethylamino)-N-(1-methylsulfonylpropan-2-yl)oxolane-3-carboxamide (PubChem CID 66259891) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-(ethylamino)-N-(1-methylsulfonylpropan-2-yl)oxolane-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-(1-methylsulfonylpropan-2-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66259891 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-(ethylamino)-N-(1-methylsulfonylpropan-2-yl)oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)NC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O4S/c1-4-12-10-6-17-5-9(10)11(14)13-8(2)7-18(3,15)16/h8-10,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | AARAZENRFUEPOU-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |