About 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide
4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide (PubChem CID 107221645) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide |
| PubChem CID | 107221645 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C13H24N2O3/c1-2-14-11-8-18-7-9(11)13(17)15-10-5-3-4-6-12(10)16/h9-12,14,16H,2-8H2,1H3,(H,15,17)/t9?,10-,11?,12-/m0/s1 |
| InChIKey | SOZOTASMVSHCAX-ADPBJBESSA-N |
| XLogP | 0.03 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide?
The IUPAC name of 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide (CID 107221645) is 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide.
What is the SMILES notation for 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide?
The canonical SMILES for 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide is CCNC1COCC1C(=O)N[C@H]1CCCC[C@@H]1O.
What is the InChIKey of 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide?
The InChIKey is SOZOTASMVSHCAX-ADPBJBESSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-2-14-11-8-18-7-9(11)13(17)15-10-5-3-4-6-12(10)16/h9-12,14,16H,2-8H2,1H3,(H,15,17)/t9?,10-,11?,12-/m0/s1.
What are the key properties of 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide?
4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide has a molecular weight of 256.35 g/mol, XLogP of 0.03, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-N-[(1S,2S)-2-hydroxycyclohexyl]oxolane-3-carboxamide is sourced from PubChem (CID 107221645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).