C14H23F3N2O2 — CID 66259260
4-(ethylamino)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-3-carboxamide (PubChem CID 66259260) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-(ethylamino)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66259260 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-(ethylamino)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-3-carboxamide |
| SMILES | CCNC1COCC1C(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3N2O2/c1-2-18-12-8-21-7-11(12)13(20)19-10-5-3-9(4-6-10)14(15,16)17/h9-12,18H,2-8H2,1H3,(H,19,20) |
| InChIKey | HLPMVKDWMKJKFV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |