C9H13F4N3 — CID 106291716
2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]propan-2-amine (PubChem CID 106291716) has the molecular formula C9H13F4N3 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]propan-2-amine.
| Compound Name | 2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 106291716 |
| Molecular Formula | C9H13F4N3 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]propan-2-amine |
| SMILES | CC(C)(N)c1cncn1CC(F)(F)C(F)F |
| InChI | InChI=1S/C9H13F4N3/c1-8(2,14)6-3-15-5-16(6)4-9(12,13)7(10)11/h3,5,7H,4,14H2,1-2H3 |
| InChIKey | BSTAEMXGXIHJAO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|