C11H17F4N3 — CID 114169292
3-methyl-2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]butan-1-amine (PubChem CID 114169292) has the molecular formula C11H17F4N3 and a molecular weight of 267.27 g/mol. Its IUPAC name is 3-methyl-2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]butan-1-amine.
| Compound Name | 3-methyl-2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]butan-1-amine |
|---|---|
| PubChem CID | 114169292 |
| Molecular Formula | C11H17F4N3 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-methyl-2-[3-(2,2,3,3-tetrafluoropropyl)imidazol-4-yl]butan-1-amine |
| SMILES | CC(C)C(CN)c1cncn1CC(F)(F)C(F)F |
| InChI | InChI=1S/C11H17F4N3/c1-7(2)8(3-16)9-4-17-6-18(9)5-11(14,15)10(12)13/h4,6-8,10H,3,5,16H2,1-2H3 |
| InChIKey | HRSAIXNCJDBTFF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|