C15H19F2N3S — CID 107443932
2-[3-[2-(difluoromethylsulfanyl)phenyl]imidazol-4-yl]-3-methylbutan-1-amine (PubChem CID 107443932) has the molecular formula C15H19F2N3S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-[3-[2-(difluoromethylsulfanyl)phenyl]imidazol-4-yl]-3-methylbutan-1-amine.
| Compound Name | 2-[3-[2-(difluoromethylsulfanyl)phenyl]imidazol-4-yl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 107443932 |
| Molecular Formula | C15H19F2N3S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[3-[2-(difluoromethylsulfanyl)phenyl]imidazol-4-yl]-3-methylbutan-1-amine |
| SMILES | CC(C)C(CN)c1cncn1-c1ccccc1SC(F)F |
| InChI | InChI=1S/C15H19F2N3S/c1-10(2)11(7-18)13-8-19-9-20(13)12-5-3-4-6-14(12)21-15(16)17/h3-6,8-11,15H,7,18H2,1-2H3 |
| InChIKey | XXOQMAZLFRWISK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |