C12H23N3 — CID 107443976
2-(3-tert-butylimidazol-4-yl)-3-methylbutan-1-amine (PubChem CID 107443976) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-(3-tert-butylimidazol-4-yl)-3-methylbutan-1-amine.
| Compound Name | 2-(3-tert-butylimidazol-4-yl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 107443976 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-(3-tert-butylimidazol-4-yl)-3-methylbutan-1-amine |
| SMILES | CC(C)C(CN)c1cncn1C(C)(C)C |
| InChI | InChI=1S/C12H23N3/c1-9(2)10(6-13)11-7-14-8-15(11)12(3,4)5/h7-10H,6,13H2,1-5H3 |
| InChIKey | HMSIMDZOMYKISD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |