About 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol
1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol (PubChem CID 106293010) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol.
Molecular Properties
| Compound Name | 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol |
| PubChem CID | 106293010 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol |
| SMILES | CCCC(C)(O)CNCc1cc(C)nn1C |
| InChI | InChI=1S/C12H23N3O/c1-5-6-12(3,16)9-13-8-11-7-10(2)14-15(11)4/h7,13,16H,5-6,8-9H2,1-4H3 |
| InChIKey | WFTKKYGFSNSAIY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol?
The IUPAC name of 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol (CID 106293010) is 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol.
What is the SMILES notation for 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol?
The canonical SMILES for 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol is CCCC(C)(O)CNCc1cc(C)nn1C.
What is the InChIKey of 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol?
The InChIKey is WFTKKYGFSNSAIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-5-6-12(3,16)9-13-8-11-7-10(2)14-15(11)4/h7,13,16H,5-6,8-9H2,1-4H3.
What are the key properties of 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol?
1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol has a molecular weight of 225.34 g/mol, XLogP of 1.37, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dimethylpyrazol-3-yl)methylamino]-2-methylpentan-2-ol is sourced from PubChem (CID 106293010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).