C13H25N3O2 — CID 114164718
1-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 114164718) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 114164718 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 1-[(2-ethyl-5-methylpyrazol-3-yl)methylamino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | CCn1nc(C)cc1CNCC(C)(O)CCOC |
| InChI | InChI=1S/C13H25N3O2/c1-5-16-12(8-11(2)15-16)9-14-10-13(3,17)6-7-18-4/h8,14,17H,5-7,9-10H2,1-4H3 |
| InChIKey | IVXKPOBZQKTRTR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |