C12H15F4N3O — CID 106293122
N'-hydroxy-3-phenyl-3-(2,2,3,3-tetrafluoropropylamino)propanimidamide (PubChem CID 106293122) has the molecular formula C12H15F4N3O and a molecular weight of 293.26 g/mol. Its IUPAC name is N'-hydroxy-3-phenyl-3-(2,2,3,3-tetrafluoropropylamino)propanimidamide.
| Compound Name | N'-hydroxy-3-phenyl-3-(2,2,3,3-tetrafluoropropylamino)propanimidamide |
|---|---|
| PubChem CID | 106293122 |
| Molecular Formula | C12H15F4N3O |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N'-hydroxy-3-phenyl-3-(2,2,3,3-tetrafluoropropylamino)propanimidamide |
| SMILES | N/C(CC(NCC(F)(F)C(F)F)c1ccccc1)=N/O |
| InChI | InChI=1S/C12H15F4N3O/c13-11(14)12(15,16)7-18-9(6-10(17)19-20)8-4-2-1-3-5-8/h1-5,9,11,18,20H,6-7H2,(H2,17,19) |
| InChIKey | IEAWSFKLPLRTPA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|