C14H23N3O2 — CID 107317928
N'-hydroxy-3-(5-hydroxypentylamino)-3-phenylpropanimidamide (PubChem CID 107317928) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is N'-hydroxy-3-(5-hydroxypentylamino)-3-phenylpropanimidamide.
| Compound Name | N'-hydroxy-3-(5-hydroxypentylamino)-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 107317928 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N'-hydroxy-3-(5-hydroxypentylamino)-3-phenylpropanimidamide |
| SMILES | N/C(CC(NCCCCCO)c1ccccc1)=N/O |
| InChI | InChI=1S/C14H23N3O2/c15-14(17-19)11-13(12-7-3-1-4-8-12)16-9-5-2-6-10-18/h1,3-4,7-8,13,16,18-19H,2,5-6,9-11H2,(H2,15,17) |
| InChIKey | XJISFDYUFDKXEV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|