C10H7F4N3O2 — CID 106293446
3-(2,2,3,3-tetrafluoropropyl)benzotriazole-4-carboxylic acid (PubChem CID 106293446) has the molecular formula C10H7F4N3O2 and a molecular weight of 277.18 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropyl)benzotriazole-4-carboxylic acid.
| Compound Name | 3-(2,2,3,3-tetrafluoropropyl)benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106293446 |
| Molecular Formula | C10H7F4N3O2 |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropyl)benzotriazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2nnn(CC(F)(F)C(F)F)c12 |
| InChI | InChI=1S/C10H7F4N3O2/c11-9(12)10(13,14)4-17-7-5(8(18)19)2-1-3-6(7)15-16-17/h1-3,9H,4H2,(H,18,19) |
| InChIKey | YXHYPMVTORXYFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|