C11H13N3O2S — CID 112576726
3-(3-methylsulfanylpropyl)benzotriazole-4-carboxylic acid (PubChem CID 112576726) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-(3-methylsulfanylpropyl)benzotriazole-4-carboxylic acid.
| Compound Name | 3-(3-methylsulfanylpropyl)benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 112576726 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(3-methylsulfanylpropyl)benzotriazole-4-carboxylic acid |
| SMILES | CSCCCn1nnc2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C11H13N3O2S/c1-17-7-3-6-14-10-8(11(15)16)4-2-5-9(10)12-13-14/h2,4-5H,3,6-7H2,1H3,(H,15,16) |
| InChIKey | XVRGBQLALZKNAF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|