C9H12F4N4O — CID 106293692
5-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 106293692) has the molecular formula C9H12F4N4O and a molecular weight of 268.21 g/mol. Its IUPAC name is 5-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 106293692 |
| Molecular Formula | C9H12F4N4O |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 5-propan-2-yl-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)c1nc(C(=O)NCC(F)(F)C(F)F)n[nH]1 |
| InChI | InChI=1S/C9H12F4N4O/c1-4(2)5-15-6(17-16-5)7(18)14-3-9(12,13)8(10)11/h4,8H,3H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | UOGHDYRIMXQPQA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|