C8H9F4N3S — CID 106293804
6-methylsulfanyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine (PubChem CID 106293804) has the molecular formula C8H9F4N3S and a molecular weight of 255.24 g/mol. Its IUPAC name is 6-methylsulfanyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine.
| Compound Name | 6-methylsulfanyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106293804 |
| Molecular Formula | C8H9F4N3S |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 6-methylsulfanyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine |
| SMILES | CSc1cc(NCC(F)(F)C(F)F)ncn1 |
| InChI | InChI=1S/C8H9F4N3S/c1-16-6-2-5(14-4-15-6)13-3-8(11,12)7(9)10/h2,4,7H,3H2,1H3,(H,13,14,15) |
| InChIKey | DXDRXUKMXYSXIY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|