C13H22F4N2O — CID 106294005
8,8-dimethyl-7-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 106294005) has the molecular formula C13H22F4N2O and a molecular weight of 298.32 g/mol. Its IUPAC name is 8,8-dimethyl-7-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine.
| Compound Name | 8,8-dimethyl-7-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 106294005 |
| Molecular Formula | C13H22F4N2O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 8,8-dimethyl-7-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | CC1(C)C2OCCCC2C1(N)CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H22F4N2O/c1-11(2)9-8(4-3-5-20-9)12(11,18)6-19-7-13(16,17)10(14)15/h8-10,19H,3-7,18H2,1-2H3 |
| InChIKey | FSTCGSSUQGKQLE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|