C15H27F3N2O — CID 114948245
8,8-dimethyl-7-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 114948245) has the molecular formula C15H27F3N2O and a molecular weight of 308.39 g/mol. Its IUPAC name is 8,8-dimethyl-7-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine.
| Compound Name | 8,8-dimethyl-7-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 114948245 |
| Molecular Formula | C15H27F3N2O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 8,8-dimethyl-7-[(5,5,5-trifluoropentylamino)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | CC1(C)C2OCCCC2C1(N)CNCCCCC(F)(F)F |
| InChI | InChI=1S/C15H27F3N2O/c1-13(2)12-11(6-5-9-21-12)14(13,19)10-20-8-4-3-7-15(16,17)18/h11-12,20H,3-10,19H2,1-2H3 |
| InChIKey | RJKSJZJZWYNTIP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|