C12H19F4NO — CID 114168995
8,8-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 114168995) has the molecular formula C12H19F4NO and a molecular weight of 269.28 g/mol. Its IUPAC name is 8,8-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-2-oxabicyclo[4.2.0]octan-7-amine.
| Compound Name | 8,8-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-2-oxabicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 114168995 |
| Molecular Formula | C12H19F4NO |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 8,8-dimethyl-N-(2,2,3,3-tetrafluoropropyl)-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | CC1(C)C(NCC(F)(F)C(F)F)C2CCCOC21 |
| InChI | InChI=1S/C12H19F4NO/c1-11(2)8(7-4-3-5-18-9(7)11)17-6-12(15,16)10(13)14/h7-10,17H,3-6H2,1-2H3 |
| InChIKey | IXKWYVSELKRYEI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|