C13H24F4N2 — CID 106294228
5-butan-2-yl-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)piperazine (PubChem CID 106294228) has the molecular formula C13H24F4N2 and a molecular weight of 284.34 g/mol. Its IUPAC name is 5-butan-2-yl-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)piperazine.
| Compound Name | 5-butan-2-yl-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)piperazine |
|---|---|
| PubChem CID | 106294228 |
| Molecular Formula | C13H24F4N2 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 5-butan-2-yl-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)piperazine |
| SMILES | CCC(C)C1CN(CC(F)(F)C(F)F)C(CC)CN1 |
| InChI | InChI=1S/C13H24F4N2/c1-4-9(3)11-7-19(10(5-2)6-18-11)8-13(16,17)12(14)15/h9-12,18H,4-8H2,1-3H3 |
| InChIKey | SSPLUOBPZMVVMN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|