C13H25F3N2 — CID 64847845
5-butan-2-yl-2-propyl-1-(2,2,2-trifluoroethyl)piperazine (PubChem CID 64847845) has the molecular formula C13H25F3N2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 5-butan-2-yl-2-propyl-1-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 5-butan-2-yl-2-propyl-1-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 64847845 |
| Molecular Formula | C13H25F3N2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 5-butan-2-yl-2-propyl-1-(2,2,2-trifluoroethyl)piperazine |
| SMILES | CCCC1CNC(C(C)CC)CN1CC(F)(F)F |
| InChI | InChI=1S/C13H25F3N2/c1-4-6-11-7-17-12(10(3)5-2)8-18(11)9-13(14,15)16/h10-12,17H,4-9H2,1-3H3 |
| InChIKey | OUWNJHXNWAIZAQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |