C16H31F3N2 — CID 115518959
2,5-di(butan-2-yl)-1-(4,4,4-trifluorobutyl)piperazine (PubChem CID 115518959) has the molecular formula C16H31F3N2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2,5-di(butan-2-yl)-1-(4,4,4-trifluorobutyl)piperazine.
| Compound Name | 2,5-di(butan-2-yl)-1-(4,4,4-trifluorobutyl)piperazine |
|---|---|
| PubChem CID | 115518959 |
| Molecular Formula | C16H31F3N2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2,5-di(butan-2-yl)-1-(4,4,4-trifluorobutyl)piperazine |
| SMILES | CCC(C)C1CN(CCCC(F)(F)F)C(C(C)CC)CN1 |
| InChI | InChI=1S/C16H31F3N2/c1-5-12(3)14-11-21(9-7-8-16(17,18)19)15(10-20-14)13(4)6-2/h12-15,20H,5-11H2,1-4H3 |
| InChIKey | IRVVTONFKWKWNA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |