C13H25F3N2 — CID 115519153
3-butan-2-yl-1-(4,4,4-trifluorobutyl)-1,4-diazepane (PubChem CID 115519153) has the molecular formula C13H25F3N2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 3-butan-2-yl-1-(4,4,4-trifluorobutyl)-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(4,4,4-trifluorobutyl)-1,4-diazepane |
|---|---|
| PubChem CID | 115519153 |
| Molecular Formula | C13H25F3N2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 3-butan-2-yl-1-(4,4,4-trifluorobutyl)-1,4-diazepane |
| SMILES | CCC(C)C1CN(CCCC(F)(F)F)CCCN1 |
| InChI | InChI=1S/C13H25F3N2/c1-3-11(2)12-10-18(9-5-7-17-12)8-4-6-13(14,15)16/h11-12,17H,3-10H2,1-2H3 |
| InChIKey | QNNRZDWXKLRFAD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |