C12H23F3N2 — CID 64858415
3-butan-2-yl-1-(3,3,3-trifluoropropyl)-1,4-diazepane (PubChem CID 64858415) has the molecular formula C12H23F3N2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-butan-2-yl-1-(3,3,3-trifluoropropyl)-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(3,3,3-trifluoropropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64858415 |
| Molecular Formula | C12H23F3N2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 3-butan-2-yl-1-(3,3,3-trifluoropropyl)-1,4-diazepane |
| SMILES | CCC(C)C1CN(CCC(F)(F)F)CCCN1 |
| InChI | InChI=1S/C12H23F3N2/c1-3-10(2)11-9-17(7-4-6-16-11)8-5-12(13,14)15/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | ATBPAUMZQZNPDS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |