C14H30N2S — CID 113488328
3-butan-2-yl-1-(4-methylsulfanylbutyl)-1,4-diazepane (PubChem CID 113488328) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is 3-butan-2-yl-1-(4-methylsulfanylbutyl)-1,4-diazepane.
| Compound Name | 3-butan-2-yl-1-(4-methylsulfanylbutyl)-1,4-diazepane |
|---|---|
| PubChem CID | 113488328 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3-butan-2-yl-1-(4-methylsulfanylbutyl)-1,4-diazepane |
| SMILES | CCC(C)C1CN(CCCCSC)CCCN1 |
| InChI | InChI=1S/C14H30N2S/c1-4-13(2)14-12-16(10-7-8-15-14)9-5-6-11-17-3/h13-15H,4-12H2,1-3H3 |
| InChIKey | HQKTYCWIKUJDQC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|