C18H29IN2 — CID 65490972
5-butan-2-yl-1-[(4-iodophenyl)methyl]-2-propylpiperazine (PubChem CID 65490972) has the molecular formula C18H29IN2 and a molecular weight of 400.35 g/mol. Its IUPAC name is 5-butan-2-yl-1-[(4-iodophenyl)methyl]-2-propylpiperazine.
| Compound Name | 5-butan-2-yl-1-[(4-iodophenyl)methyl]-2-propylpiperazine |
|---|---|
| PubChem CID | 65490972 |
| Molecular Formula | C18H29IN2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 5-butan-2-yl-1-[(4-iodophenyl)methyl]-2-propylpiperazine |
| SMILES | CCCC1CNC(C(C)CC)CN1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C18H29IN2/c1-4-6-17-11-20-18(14(3)5-2)13-21(17)12-15-7-9-16(19)10-8-15/h7-10,14,17-18,20H,4-6,11-13H2,1-3H3 |
| InChIKey | XKEIFCAOIKIHOJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|