C9H9F4N3O2 — CID 106294341
4-[(2,2,3,3-tetrafluoropropylamino)methyl]pyrimidine-5-carboxylic acid (PubChem CID 106294341) has the molecular formula C9H9F4N3O2 and a molecular weight of 267.18 g/mol. Its IUPAC name is 4-[(2,2,3,3-tetrafluoropropylamino)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(2,2,3,3-tetrafluoropropylamino)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 106294341 |
| Molecular Formula | C9H9F4N3O2 |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-[(2,2,3,3-tetrafluoropropylamino)methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F4N3O2/c10-8(11)9(12,13)3-14-2-6-5(7(17)18)1-15-4-16-6/h1,4,8,14H,2-3H2,(H,17,18) |
| InChIKey | CNCJAKAIIPMDCW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|