C13H21F4NO3 — CID 106294385
ethyl 4-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclohexane-1-carboxylate (PubChem CID 106294385) has the molecular formula C13H21F4NO3 and a molecular weight of 315.31 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106294385 |
| Molecular Formula | C13H21F4NO3 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | ethyl 4-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CNCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C13H21F4NO3/c1-2-21-10(19)9-3-5-12(20,6-4-9)7-18-8-13(16,17)11(14)15/h9,11,18,20H,2-8H2,1H3 |
| InChIKey | USLKMSNIGVIRHA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|