C7H9F4N3O2S2 — CID 106294637
2-amino-4-methyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-sulfonamide (PubChem CID 106294637) has the molecular formula C7H9F4N3O2S2 and a molecular weight of 307.29 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-4-methyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 106294637 |
| Molecular Formula | C7H9F4N3O2S2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 2-amino-4-methyl-N-(2,2,3,3-tetrafluoropropyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4N3O2S2/c1-3-4(17-6(12)14-3)18(15,16)13-2-7(10,11)5(8)9/h5,13H,2H2,1H3,(H2,12,14) |
| InChIKey | FQPPBAKLVWBBMB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|