C9H10F4N2O2S — CID 106295398
ethyl 5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylate (PubChem CID 106295398) has the molecular formula C9H10F4N2O2S and a molecular weight of 286.25 g/mol. Its IUPAC name is ethyl 5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106295398 |
| Molecular Formula | C9H10F4N2O2S |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | ethyl 5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H10F4N2O2S/c1-2-17-7(16)5-6(18-4-15-5)14-3-9(12,13)8(10)11/h4,8,14H,2-3H2,1H3 |
| InChIKey | WXSHZVYYHOQRSO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|