C10H12F4N2O2S — CID 106295441
ethyl 3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylate (PubChem CID 106295441) has the molecular formula C10H12F4N2O2S and a molecular weight of 300.28 g/mol. Its IUPAC name is ethyl 3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | ethyl 3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106295441 |
| Molecular Formula | C10H12F4N2O2S |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | ethyl 3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nsc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F4N2O2S/c1-3-18-8(17)6-5(2)16-19-7(6)15-4-10(13,14)9(11)12/h9,15H,3-4H2,1-2H3 |
| InChIKey | PAWHVVGBHVLSPB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|