C11H9F4NO3S — CID 106295453
(E)-3-[5-(2,2,3,3-tetrafluoropropylcarbamoyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 106295453) has the molecular formula C11H9F4NO3S and a molecular weight of 311.26 g/mol. Its IUPAC name is (E)-3-[5-(2,2,3,3-tetrafluoropropylcarbamoyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(2,2,3,3-tetrafluoropropylcarbamoyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106295453 |
| Molecular Formula | C11H9F4NO3S |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (E)-3-[5-(2,2,3,3-tetrafluoropropylcarbamoyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)NCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C11H9F4NO3S/c12-10(13)11(14,15)5-16-9(19)7-3-1-6(20-7)2-4-8(17)18/h1-4,10H,5H2,(H,16,19)(H,17,18)/b4-2+ |
| InChIKey | JGJTWLBUYMBMMX-DUXPYHPUSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|