C7H10F4N4O — CID 106296571
5-(2-aminoethyl)-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106296571) has the molecular formula C7H10F4N4O and a molecular weight of 242.18 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-aminoethyl)-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106296571 |
| Molecular Formula | C7H10F4N4O |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 5-(2-aminoethyl)-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | NCCc1nnc(NCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C7H10F4N4O/c8-5(9)7(10,11)3-13-6-15-14-4(16-6)1-2-12/h5H,1-3,12H2,(H,13,15) |
| InChIKey | MRMSPRCKFHSGFJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|