C9H18N4O — CID 106966297
5-(2-aminoethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine (PubChem CID 106966297) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-aminoethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106966297 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 5-(2-aminoethyl)-N-pentan-2-yl-1,3,4-oxadiazol-2-amine |
| SMILES | CCCC(C)Nc1nnc(CCN)o1 |
| InChI | InChI=1S/C9H18N4O/c1-3-4-7(2)11-9-13-12-8(14-9)5-6-10/h7H,3-6,10H2,1-2H3,(H,11,13) |
| InChIKey | DBAZVJFBXHFQST-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |